C16H16BrFN2O3 — CID 27821732
5-bromo-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 27821732) has the molecular formula C16H16BrFN2O3 and a molecular weight of 383.22 g/mol. Its IUPAC name is 5-bromo-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 27821732 |
| Molecular Formula | C16H16BrFN2O3 |
| Molecular Weight | 383.22 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 5-bromo-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C16H16BrFN2O3/c1-2-20(16(22)13-7-8-14(17)23-13)10-15(21)19-9-11-3-5-12(18)6-4-11/h3-8H,2,9-10H2,1H3,(H,19,21) |
| InChIKey | FJVBGISCLJUUMK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |