C17H19FN2O3 — CID 18113075
N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-methylfuran-3-carboxamide (PubChem CID 18113075) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 18113075 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-methylfuran-3-carboxamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)c1ccoc1C |
| InChI | InChI=1S/C17H19FN2O3/c1-3-20(17(22)15-8-9-23-12(15)2)11-16(21)19-10-13-4-6-14(18)7-5-13/h4-9H,3,10-11H2,1-2H3,(H,19,21) |
| InChIKey | WJTSGYVNDFFHSX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |