C15H12ClFN2O3 — CID 108519764
N'-(5-chloro-2-hydroxyphenyl)-N-[(4-fluorophenyl)methyl]oxamide (PubChem CID 108519764) has the molecular formula C15H12ClFN2O3 and a molecular weight of 322.72 g/mol. Its IUPAC name is N'-(5-chloro-2-hydroxyphenyl)-N-[(4-fluorophenyl)methyl]oxamide.
| Compound Name | N'-(5-chloro-2-hydroxyphenyl)-N-[(4-fluorophenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108519764 |
| Molecular Formula | C15H12ClFN2O3 |
| Molecular Weight | 322.72 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | N'-(5-chloro-2-hydroxyphenyl)-N-[(4-fluorophenyl)methyl]oxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C(=O)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H12ClFN2O3/c16-10-3-6-13(20)12(7-10)19-15(22)14(21)18-8-9-1-4-11(17)5-2-9/h1-7,20H,8H2,(H,18,21)(H,19,22) |
| InChIKey | QLQCSJNSVRTSKW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.72 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|