C15H13ClFN3O2 — CID 108516187
N'-(4-amino-3-chlorophenyl)-N-[(4-fluorophenyl)methyl]oxamide (PubChem CID 108516187) has the molecular formula C15H13ClFN3O2 and a molecular weight of 321.74 g/mol. Its IUPAC name is N'-(4-amino-3-chlorophenyl)-N-[(4-fluorophenyl)methyl]oxamide.
| Compound Name | N'-(4-amino-3-chlorophenyl)-N-[(4-fluorophenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108516187 |
| Molecular Formula | C15H13ClFN3O2 |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N'-(4-amino-3-chlorophenyl)-N-[(4-fluorophenyl)methyl]oxamide |
| SMILES | Nc1ccc(NC(=O)C(=O)NCc2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C15H13ClFN3O2/c16-12-7-11(5-6-13(12)18)20-15(22)14(21)19-8-9-1-3-10(17)4-2-9/h1-7H,8,18H2,(H,19,21)(H,20,22) |
| InChIKey | WYCXQJVGDKPDCY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|