C11H13FN2O3 — CID 44996845
N'-[(4-fluorophenyl)methyl]-N-(2-hydroxyethyl)oxamide (PubChem CID 44996845) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is N'-[(4-fluorophenyl)methyl]-N-(2-hydroxyethyl)oxamide.
| Compound Name | N'-[(4-fluorophenyl)methyl]-N-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 44996845 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N'-[(4-fluorophenyl)methyl]-N-(2-hydroxyethyl)oxamide |
| SMILES | O=C(NCCO)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C11H13FN2O3/c12-9-3-1-8(2-4-9)7-14-11(17)10(16)13-5-6-15/h1-4,15H,5-7H2,(H,13,16)(H,14,17) |
| InChIKey | SUVZZERSBFEDOH-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|