C12H17N3O3 — CID 107229543
N-(2-aminoethyl)-N'-[[4-(hydroxymethyl)phenyl]methyl]oxamide (PubChem CID 107229543) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[[4-(hydroxymethyl)phenyl]methyl]oxamide.
| Compound Name | N-(2-aminoethyl)-N'-[[4-(hydroxymethyl)phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 107229543 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-(2-aminoethyl)-N'-[[4-(hydroxymethyl)phenyl]methyl]oxamide |
| SMILES | NCCNC(=O)C(=O)NCc1ccc(CO)cc1 |
| InChI | InChI=1S/C12H17N3O3/c13-5-6-14-11(17)12(18)15-7-9-1-3-10(8-16)4-2-9/h1-4,16H,5-8,13H2,(H,14,17)(H,15,18) |
| InChIKey | RUJXLMBKJDGVQR-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|