C10H7F3N4O — CID 110487427
N-(1H-1,2,4-triazol-5-yl)-2-(2,3,4-trifluorophenyl)acetamide (PubChem CID 110487427) has the molecular formula C10H7F3N4O and a molecular weight of 256.19 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-yl)-2-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | N-(1H-1,2,4-triazol-5-yl)-2-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 110487427 |
| Molecular Formula | C10H7F3N4O |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-yl)-2-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)c(F)c1F)Nc1ncn[nH]1 |
| InChI | InChI=1S/C10H7F3N4O/c11-6-2-1-5(8(12)9(6)13)3-7(18)16-10-14-4-15-17-10/h1-2,4H,3H2,(H2,14,15,16,17,18) |
| InChIKey | VUXDPFWYUKCZQR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|