C18H17FO5 — CID 67426120
methyl 4-[3-[(4-fluorophenyl)methyl]-4,5-dimethylfuran-2-yl]-4-hydroxy-2-oxobut-3-enoate (PubChem CID 67426120) has the molecular formula C18H17FO5 and a molecular weight of 332.33 g/mol. Its IUPAC name is methyl 4-[3-[(4-fluorophenyl)methyl]-4,5-dimethylfuran-2-yl]-4-hydroxy-2-oxobut-3-enoate.
| Compound Name | methyl 4-[3-[(4-fluorophenyl)methyl]-4,5-dimethylfuran-2-yl]-4-hydroxy-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 67426120 |
| Molecular Formula | C18H17FO5 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | methyl 4-[3-[(4-fluorophenyl)methyl]-4,5-dimethylfuran-2-yl]-4-hydroxy-2-oxobut-3-enoate |
| SMILES | COC(=O)C(=O)C=C(O)c1oc(C)c(C)c1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FO5/c1-10-11(2)24-17(15(20)9-16(21)18(22)23-3)14(10)8-12-4-6-13(19)7-5-12/h4-7,9,20H,8H2,1-3H3 |
| InChIKey | QXANMNJNKSYQKJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|