C16H13FN2O5 — CID 87151785
methyl (Z)-5-[3-[(4-fluorophenyl)methyl]imidazol-4-yl]-4-hydroxy-2,5-dioxopent-3-enoate (PubChem CID 87151785) has the molecular formula C16H13FN2O5 and a molecular weight of 332.29 g/mol. Its IUPAC name is methyl (Z)-5-[3-[(4-fluorophenyl)methyl]imidazol-4-yl]-4-hydroxy-2,5-dioxopent-3-enoate.
| Compound Name | methyl (Z)-5-[3-[(4-fluorophenyl)methyl]imidazol-4-yl]-4-hydroxy-2,5-dioxopent-3-enoate |
|---|---|
| PubChem CID | 87151785 |
| Molecular Formula | C16H13FN2O5 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | methyl (Z)-5-[3-[(4-fluorophenyl)methyl]imidazol-4-yl]-4-hydroxy-2,5-dioxopent-3-enoate |
| SMILES | COC(=O)C(=O)/C=C(\O)C(=O)c1cncn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN2O5/c1-24-16(23)14(21)6-13(20)15(22)12-7-18-9-19(12)8-10-2-4-11(17)5-3-10/h2-7,9,20H,8H2,1H3/b13-6- |
| InChIKey | FKTIJBDXXPMNQO-MLPAPPSSSA-N |
| XLogP | 1.44 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|