C18H18FN3O3 — CID 91429221
4-[3-[(4-fluorophenyl)methyl]imidazole-4-carbonyl]-1-propan-2-ylpyrrolidine-2,3-dione (PubChem CID 91429221) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is 4-[3-[(4-fluorophenyl)methyl]imidazole-4-carbonyl]-1-propan-2-ylpyrrolidine-2,3-dione.
| Compound Name | 4-[3-[(4-fluorophenyl)methyl]imidazole-4-carbonyl]-1-propan-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91429221 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-[3-[(4-fluorophenyl)methyl]imidazole-4-carbonyl]-1-propan-2-ylpyrrolidine-2,3-dione |
| SMILES | CC(C)N1CC(C(=O)c2cncn2Cc2ccc(F)cc2)C(=O)C1=O |
| InChI | InChI=1S/C18H18FN3O3/c1-11(2)22-9-14(17(24)18(22)25)16(23)15-7-20-10-21(15)8-12-3-5-13(19)6-4-12/h3-7,10-11,14H,8-9H2,1-2H3 |
| InChIKey | CNRRNFJEIWKOEG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|