C13H13FN2 — CID 116811649
5-cyclopropyl-1-[(4-fluorophenyl)methyl]imidazole (PubChem CID 116811649) has the molecular formula C13H13FN2 and a molecular weight of 216.26 g/mol. Its IUPAC name is 5-cyclopropyl-1-[(4-fluorophenyl)methyl]imidazole.
| Compound Name | 5-cyclopropyl-1-[(4-fluorophenyl)methyl]imidazole |
|---|---|
| PubChem CID | 116811649 |
| Molecular Formula | C13H13FN2 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 5-cyclopropyl-1-[(4-fluorophenyl)methyl]imidazole |
| SMILES | Fc1ccc(Cn2cncc2C2CC2)cc1 |
| InChI | InChI=1S/C13H13FN2/c14-12-5-1-10(2-6-12)8-16-9-15-7-13(16)11-3-4-11/h1-2,5-7,9,11H,3-4,8H2 |
| InChIKey | ZOYRZTWEQYRNML-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |