C14H18N4 — CID 114703940
4-[(5-piperidin-4-ylimidazol-1-yl)methyl]pyridine (PubChem CID 114703940) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 4-[(5-piperidin-4-ylimidazol-1-yl)methyl]pyridine.
| Compound Name | 4-[(5-piperidin-4-ylimidazol-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 114703940 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-[(5-piperidin-4-ylimidazol-1-yl)methyl]pyridine |
| SMILES | c1cc(Cn2cncc2C2CCNCC2)ccn1 |
| InChI | InChI=1S/C14H18N4/c1-5-15-6-2-12(1)10-18-11-17-9-14(18)13-3-7-16-8-4-13/h1-2,5-6,9,11,13,16H,3-4,7-8,10H2 |
| InChIKey | LLQNUQHPVBGZHO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |