C18H22FN3O — CID 56868776
[3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(3-methylimidazol-4-yl)methanone (PubChem CID 56868776) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is [3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(3-methylimidazol-4-yl)methanone.
| Compound Name | [3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(3-methylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 56868776 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | [3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(3-methylimidazol-4-yl)methanone |
| SMILES | Cn1cncc1C(=O)N1CCCC(CCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H22FN3O/c1-21-13-20-11-17(21)18(23)22-10-2-3-15(12-22)5-4-14-6-8-16(19)9-7-14/h6-9,11,13,15H,2-5,10,12H2,1H3 |
| InChIKey | NLXQCAALFXQGTO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |