C11H18N4O — CID 103510238
[3-(aminomethyl)piperidin-1-yl]-(3-methylimidazol-4-yl)methanone (PubChem CID 103510238) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is [3-(aminomethyl)piperidin-1-yl]-(3-methylimidazol-4-yl)methanone.
| Compound Name | [3-(aminomethyl)piperidin-1-yl]-(3-methylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 103510238 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | [3-(aminomethyl)piperidin-1-yl]-(3-methylimidazol-4-yl)methanone |
| SMILES | Cn1cncc1C(=O)N1CCCC(CN)C1 |
| InChI | InChI=1S/C11H18N4O/c1-14-8-13-6-10(14)11(16)15-4-2-3-9(5-12)7-15/h6,8-9H,2-5,7,12H2,1H3 |
| InChIKey | SAOKGUKILCFCGD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |