C19H20F2N2O — CID 56879699
[3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(3-fluoro-4-pyridinyl)methanone (PubChem CID 56879699) has the molecular formula C19H20F2N2O and a molecular weight of 330.38 g/mol. Its IUPAC name is [3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(3-fluoro-4-pyridinyl)methanone.
| Compound Name | [3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(3-fluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 56879699 |
| Molecular Formula | C19H20F2N2O |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(3-fluoro-4-pyridinyl)methanone |
| SMILES | O=C(c1ccncc1F)N1CCCC(CCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H20F2N2O/c20-16-7-5-14(6-8-16)3-4-15-2-1-11-23(13-15)19(24)17-9-10-22-12-18(17)21/h5-10,12,15H,1-4,11,13H2 |
| InChIKey | ZUJDOMQDKZQMAY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |