C16H14N2O6 — CID 58914576
methyl (Z)-4-(1-benzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoate (PubChem CID 58914576) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is methyl (Z)-4-(1-benzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoate.
| Compound Name | methyl (Z)-4-(1-benzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 58914576 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | methyl (Z)-4-(1-benzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoate |
| SMILES | COC(=O)C(=O)/C=C(\O)c1cn(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H14N2O6/c1-24-15(22)13(20)7-12(19)11-9-18(16(23)17-14(11)21)8-10-5-3-2-4-6-10/h2-7,9,19H,8H2,1H3,(H,17,21,23)/b12-7- |
| InChIKey | POASDLDFXZGJDB-GHXNOFRVSA-N |
| XLogP | 0.23 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|