C34H29NO6 — CID 74062198
methyl 4-[5-(benzhydrylperoxymethyl)-1-benzylindol-3-yl]-4-hydroxy-2-oxobut-3-enoate (PubChem CID 74062198) has the molecular formula C34H29NO6 and a molecular weight of 547.61 g/mol. Its IUPAC name is methyl 4-[5-(benzhydrylperoxymethyl)-1-benzylindol-3-yl]-4-hydroxy-2-oxobut-3-enoate.
| Compound Name | methyl 4-[5-(benzhydrylperoxymethyl)-1-benzylindol-3-yl]-4-hydroxy-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 74062198 |
| Molecular Formula | C34H29NO6 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | methyl 4-[5-(benzhydrylperoxymethyl)-1-benzylindol-3-yl]-4-hydroxy-2-oxobut-3-enoate |
| SMILES | COC(=O)C(=O)C=C(O)c1cn(Cc2ccccc2)c2ccc(COOC(c3ccccc3)c3ccccc3)cc12 |
| InChI | InChI=1S/C34H29NO6/c1-39-34(38)32(37)20-31(36)29-22-35(21-24-11-5-2-6-12-24)30-18-17-25(19-28(29)30)23-40-41-33(26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-20,22,33,36H,21,23H2,1H3 |
| InChIKey | JSEYCEZSKCSVGF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|