C20H15ClN4O2 — CID 59977476
(Z)-3-(1-benzyl-5-chloroindol-3-yl)-3-hydroxy-1-(2H-triazol-4-yl)prop-2-en-1-one (PubChem CID 59977476) has the molecular formula C20H15ClN4O2 and a molecular weight of 378.82 g/mol. Its IUPAC name is (Z)-3-(1-benzyl-5-chloroindol-3-yl)-3-hydroxy-1-(2H-triazol-4-yl)prop-2-en-1-one.
| Compound Name | (Z)-3-(1-benzyl-5-chloroindol-3-yl)-3-hydroxy-1-(2H-triazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59977476 |
| Molecular Formula | C20H15ClN4O2 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (Z)-3-(1-benzyl-5-chloroindol-3-yl)-3-hydroxy-1-(2H-triazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C(\O)c1cn(Cc2ccccc2)c2ccc(Cl)cc12)c1cn[nH]n1 |
| InChI | InChI=1S/C20H15ClN4O2/c21-14-6-7-18-15(8-14)16(12-25(18)11-13-4-2-1-3-5-13)19(26)9-20(27)17-10-22-24-23-17/h1-10,12,26H,11H2,(H,22,23,24)/b19-9- |
| InChIKey | VQTSTGBLTKRPNV-OCKHKDLRSA-N |
| XLogP | 4.24 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|