C20H21Cl2N3O — CID 10620409
5-chloro-1-[(4-chlorophenyl)methyl]-N-[2-(dimethylamino)ethyl]indole-3-carboxamide (PubChem CID 10620409) has the molecular formula C20H21Cl2N3O and a molecular weight of 390.31 g/mol. Its IUPAC name is 5-chloro-1-[(4-chlorophenyl)methyl]-N-[2-(dimethylamino)ethyl]indole-3-carboxamide.
| Compound Name | 5-chloro-1-[(4-chlorophenyl)methyl]-N-[2-(dimethylamino)ethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 10620409 |
| Molecular Formula | C20H21Cl2N3O |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 5-chloro-1-[(4-chlorophenyl)methyl]-N-[2-(dimethylamino)ethyl]indole-3-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cn(Cc2ccc(Cl)cc2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H21Cl2N3O/c1-24(2)10-9-23-20(26)18-13-25(12-14-3-5-15(21)6-4-14)19-8-7-16(22)11-17(18)19/h3-8,11,13H,9-10,12H2,1-2H3,(H,23,26) |
| InChIKey | XPXUSAFNPYZGGP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |