C25H22ClFN2O — CID 166984638
N-[2-(4-chloro-3-fluorophenyl)ethyl]-1-[(4-methylphenyl)methyl]indole-3-carboxamide (PubChem CID 166984638) has the molecular formula C25H22ClFN2O and a molecular weight of 420.92 g/mol. Its IUPAC name is N-[2-(4-chloro-3-fluorophenyl)ethyl]-1-[(4-methylphenyl)methyl]indole-3-carboxamide.
| Compound Name | N-[2-(4-chloro-3-fluorophenyl)ethyl]-1-[(4-methylphenyl)methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 166984638 |
| Molecular Formula | C25H22ClFN2O |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[2-(4-chloro-3-fluorophenyl)ethyl]-1-[(4-methylphenyl)methyl]indole-3-carboxamide |
| SMILES | Cc1ccc(Cn2cc(C(=O)NCCc3ccc(Cl)c(F)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H22ClFN2O/c1-17-6-8-19(9-7-17)15-29-16-21(20-4-2-3-5-24(20)29)25(30)28-13-12-18-10-11-22(26)23(27)14-18/h2-11,14,16H,12-13,15H2,1H3,(H,28,30) |
| InChIKey | MRZSMVYASUQFSW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |