C16H12ClNO2 — CID 10565097
1-benzyl-5-chloroindole-3-carboxylic acid (PubChem CID 10565097) has the molecular formula C16H12ClNO2 and a molecular weight of 285.73 g/mol. Its IUPAC name is 1-benzyl-5-chloroindole-3-carboxylic acid.
| Compound Name | 1-benzyl-5-chloroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 10565097 |
| Molecular Formula | C16H12ClNO2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-benzyl-5-chloroindole-3-carboxylic acid |
| SMILES | O=C(O)c1cn(Cc2ccccc2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H12ClNO2/c17-12-6-7-15-13(8-12)14(16(19)20)10-18(15)9-11-4-2-1-3-5-11/h1-8,10H,9H2,(H,19,20) |
| InChIKey | WSQPSZUEBKYERC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |