C23H20F2O5 — CID 166479578
methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate (PubChem CID 166479578) has the molecular formula C23H20F2O5 and a molecular weight of 414.40 g/mol. Its IUPAC name is methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate.
| Compound Name | methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate |
|---|---|
| PubChem CID | 166479578 |
| Molecular Formula | C23H20F2O5 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate |
| SMILES | COC(=O)c1c(F)c(OC)c(OCc2ccccc2)c(OCc2ccccc2)c1F |
| InChI | InChI=1S/C23H20F2O5/c1-27-20-18(24)17(23(26)28-2)19(25)21(29-13-15-9-5-3-6-10-15)22(20)30-14-16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | GOEAFPYTARGGBH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |