methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate

C23H20F2O5 — CID 166479578

IUPACmethyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate
SMILESCOC(=O)c1c(F)c(OC)c(OCc2ccccc2)c(OCc2ccccc2)c1F
InChIInChI=1S/C23H20F2O5/c1-27-20-18(24)17(23(26)28-2)19(25)21(29-13-15-9-5-3-6-10-15)22(20)30-14-16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3
InChIKeyGOEAFPYTARGGBH-UHFFFAOYSA-N
MW414.40 g/mol
LogP4.92
Rot. Bonds8

About methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate

methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate (PubChem CID 166479578) has the molecular formula C23H20F2O5 and a molecular weight of 414.40 g/mol. Its IUPAC name is methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate.

Molecular Properties

Compound Namemethyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate
PubChem CID166479578
Molecular FormulaC23H20F2O5
Molecular Weight414.40 g/mol
Exact Mass414.13
IUPAC Namemethyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate
SMILESCOC(=O)c1c(F)c(OC)c(OCc2ccccc2)c(OCc2ccccc2)c1F
InChIInChI=1S/C23H20F2O5/c1-27-20-18(24)17(23(26)28-2)19(25)21(29-13-15-9-5-3-6-10-15)22(20)30-14-16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3
InChIKeyGOEAFPYTARGGBH-UHFFFAOYSA-N
XLogP4.92
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms30
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500414.40
LogP ≤ 54.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate?
The IUPAC name of methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate (CID 166479578) is methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate.
What is the SMILES notation for methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate?
The canonical SMILES for methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate is COC(=O)c1c(F)c(OC)c(OCc2ccccc2)c(OCc2ccccc2)c1F.
What is the InChIKey of methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate?
The InChIKey is GOEAFPYTARGGBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F2O5/c1-27-20-18(24)17(23(26)28-2)19(25)21(29-13-15-9-5-3-6-10-15)22(20)30-14-16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3.
What are the key properties of methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate?
methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate has a molecular weight of 414.40 g/mol, XLogP of 4.92, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6-difluoro-3-methoxy-4,5-bis(phenylmethoxy)benzoate is sourced from PubChem (CID 166479578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).