C15H16BrNO — CID 169250451
2-bromo-3,5,6-trimethyl-4-phenylmethoxypyridine (PubChem CID 169250451) has the molecular formula C15H16BrNO and a molecular weight of 306.20 g/mol. Its IUPAC name is 2-bromo-3,5,6-trimethyl-4-phenylmethoxypyridine.
| Compound Name | 2-bromo-3,5,6-trimethyl-4-phenylmethoxypyridine |
|---|---|
| PubChem CID | 169250451 |
| Molecular Formula | C15H16BrNO |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 2-bromo-3,5,6-trimethyl-4-phenylmethoxypyridine |
| SMILES | Cc1nc(Br)c(C)c(OCc2ccccc2)c1C |
| InChI | InChI=1S/C15H16BrNO/c1-10-12(3)17-15(16)11(2)14(10)18-9-13-7-5-4-6-8-13/h4-8H,9H2,1-3H3 |
| InChIKey | CMXFASXRYVKTSV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|