C29H33O3P — CID 18514326
[(2,3,4,5,6-pentamethylbenzoyl)-phenylphosphoryl]-(2,3,4,6-tetramethylphenyl)methanone (PubChem CID 18514326) has the molecular formula C29H33O3P and a molecular weight of 460.55 g/mol. Its IUPAC name is [(2,3,4,5,6-pentamethylbenzoyl)-phenylphosphoryl]-(2,3,4,6-tetramethylphenyl)methanone.
| Compound Name | [(2,3,4,5,6-pentamethylbenzoyl)-phenylphosphoryl]-(2,3,4,6-tetramethylphenyl)methanone |
|---|---|
| PubChem CID | 18514326 |
| Molecular Formula | C29H33O3P |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | [(2,3,4,5,6-pentamethylbenzoyl)-phenylphosphoryl]-(2,3,4,6-tetramethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(C(=O)c2c(C)c(C)c(C)c(C)c2C)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C29H33O3P/c1-16-15-17(2)26(22(7)18(16)3)28(30)33(32,25-13-11-10-12-14-25)29(31)27-23(8)20(5)19(4)21(6)24(27)9/h10-15H,1-9H3 |
| InChIKey | UFNJVLWCGNGFOR-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|