C36H39O7P — CID 141478110
1-[2,4,6-trimethyl-3-[phenyl-[2,4,6-trimethyl-3-(1-prop-2-enoyloxyethyl)benzoyl]phosphoryl]carbonylphenyl]ethyl prop-2-enoate (PubChem CID 141478110) has the molecular formula C36H39O7P and a molecular weight of 614.68 g/mol. Its IUPAC name is 1-[2,4,6-trimethyl-3-[phenyl-[2,4,6-trimethyl-3-(1-prop-2-enoyloxyethyl)benzoyl]phosphoryl]carbonylphenyl]ethyl prop-2-enoate.
| Compound Name | 1-[2,4,6-trimethyl-3-[phenyl-[2,4,6-trimethyl-3-(1-prop-2-enoyloxyethyl)benzoyl]phosphoryl]carbonylphenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 141478110 |
| Molecular Formula | C36H39O7P |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | 1-[2,4,6-trimethyl-3-[phenyl-[2,4,6-trimethyl-3-(1-prop-2-enoyloxyethyl)benzoyl]phosphoryl]carbonylphenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)c1c(C)cc(C)c(C(=O)P(=O)(C(=O)c2c(C)cc(C)c(C(C)OC(=O)C=C)c2C)c2ccccc2)c1C |
| InChI | InChI=1S/C36H39O7P/c1-11-29(37)42-26(9)31-20(3)18-22(5)33(24(31)7)35(39)44(41,28-16-14-13-15-17-28)36(40)34-23(6)19-21(4)32(25(34)8)27(10)43-30(38)12-2/h11-19,26-27H,1-2H2,3-10H3 |
| InChIKey | USASDYBIYDTFON-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|