C23H20O2S2 — CID 118070006
1-[2,4-bis(phenylsulfanyl)phenyl]ethyl prop-2-enoate (PubChem CID 118070006) has the molecular formula C23H20O2S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 1-[2,4-bis(phenylsulfanyl)phenyl]ethyl prop-2-enoate.
| Compound Name | 1-[2,4-bis(phenylsulfanyl)phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 118070006 |
| Molecular Formula | C23H20O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 1-[2,4-bis(phenylsulfanyl)phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)c1ccc(Sc2ccccc2)cc1Sc1ccccc1 |
| InChI | InChI=1S/C23H20O2S2/c1-3-23(24)25-17(2)21-15-14-20(26-18-10-6-4-7-11-18)16-22(21)27-19-12-8-5-9-13-19/h3-17H,1H2,2H3 |
| InChIKey | HTAARECOGIYFTM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|