C50H48O10P2 — CID 155602654
1-[2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenoxy)acetyl]oxyethyl 2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenoxy)acetate (PubChem CID 155602654) has the molecular formula C50H48O10P2 and a molecular weight of 870.87 g/mol. Its IUPAC name is 1-[2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenoxy)acetyl]oxyethyl 2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenoxy)acetate.
| Compound Name | 1-[2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenoxy)acetyl]oxyethyl 2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenoxy)acetate |
|---|---|
| PubChem CID | 155602654 |
| Molecular Formula | C50H48O10P2 |
| Molecular Weight | 870.87 g/mol |
| Exact Mass | 870.27 |
| IUPAC Name | 1-[2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenoxy)acetyl]oxyethyl 2-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylphenoxy)acetate |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1OCC(=O)OC(C)OC(=O)COc1c(C)cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C50H48O10P2/c1-32-28-34(3)47(36(5)45(32)49(53)61(55,39-20-12-8-13-21-39)40-22-14-9-15-23-40)57-30-43(51)59-38(7)60-44(52)31-58-48-35(4)29-33(2)46(37(48)6)50(54)62(56,41-24-16-10-17-25-41)42-26-18-11-19-27-42/h8-29,38H,30-31H2,1-7H3 |
| InChIKey | HUZFBTBJVHVUHV-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.87 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|