C35H37O9P — CID 118231427
4-O-[[3,5-dimethyl-4-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methyl] 1-O-(2-prop-2-enoyloxyethyl) butanedioate (PubChem CID 118231427) has the molecular formula C35H37O9P and a molecular weight of 632.65 g/mol. Its IUPAC name is 4-O-[[3,5-dimethyl-4-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methyl] 1-O-(2-prop-2-enoyloxyethyl) butanedioate.
| Compound Name | 4-O-[[3,5-dimethyl-4-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methyl] 1-O-(2-prop-2-enoyloxyethyl) butanedioate |
|---|---|
| PubChem CID | 118231427 |
| Molecular Formula | C35H37O9P |
| Molecular Weight | 632.65 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | 4-O-[[3,5-dimethyl-4-[phenyl-(2,4,6-trimethylbenzoyl)phosphoryl]carbonylphenyl]methyl] 1-O-(2-prop-2-enoyloxyethyl) butanedioate |
| SMILES | C=CC(=O)OCCOC(=O)CCC(=O)OCc1cc(C)c(C(=O)P(=O)(C(=O)c2c(C)cc(C)cc2C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C35H37O9P/c1-7-29(36)42-15-16-43-30(37)13-14-31(38)44-21-27-19-25(5)33(26(6)20-27)35(40)45(41,28-11-9-8-10-12-28)34(39)32-23(3)17-22(2)18-24(32)4/h7-12,17-20H,1,13-16,21H2,2-6H3 |
| InChIKey | RAGSTXHGMJVGKM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|