C31H32NO7P — CID 118234152
4-O-[(4-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methyl] 1-O-[2-(prop-2-enoylamino)ethyl] butanedioate (PubChem CID 118234152) has the molecular formula C31H32NO7P and a molecular weight of 561.57 g/mol. Its IUPAC name is 4-O-[(4-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methyl] 1-O-[2-(prop-2-enoylamino)ethyl] butanedioate.
| Compound Name | 4-O-[(4-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methyl] 1-O-[2-(prop-2-enoylamino)ethyl] butanedioate |
|---|---|
| PubChem CID | 118234152 |
| Molecular Formula | C31H32NO7P |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 4-O-[(4-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methyl] 1-O-[2-(prop-2-enoylamino)ethyl] butanedioate |
| SMILES | C=CC(=O)NCCOC(=O)CCC(=O)OCc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C31H32NO7P/c1-4-27(33)32-17-18-38-28(34)15-16-29(35)39-21-24-19-22(2)30(23(3)20-24)31(36)40(37,25-11-7-5-8-12-25)26-13-9-6-10-14-26/h4-14,19-20H,1,15-18,21H2,2-3H3,(H,32,33) |
| InChIKey | NSTKRSASQMPQQM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|