C36H45O5P — CID 144597412
[4-[(4-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methoxy]-2-ethyl-2-methylbutyl] (E)-4-methylhex-2-enoate (PubChem CID 144597412) has the molecular formula C36H45O5P and a molecular weight of 588.73 g/mol. Its IUPAC name is [4-[(4-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methoxy]-2-ethyl-2-methylbutyl] (E)-4-methylhex-2-enoate.
| Compound Name | [4-[(4-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methoxy]-2-ethyl-2-methylbutyl] (E)-4-methylhex-2-enoate |
|---|---|
| PubChem CID | 144597412 |
| Molecular Formula | C36H45O5P |
| Molecular Weight | 588.73 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | [4-[(4-diphenylphosphorylcarbonyl-3,5-dimethylphenyl)methoxy]-2-ethyl-2-methylbutyl] (E)-4-methylhex-2-enoate |
| SMILES | CCC(C)/C=C/C(=O)OCC(C)(CC)CCOCc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C36H45O5P/c1-7-27(3)19-20-33(37)41-26-36(6,8-2)21-22-40-25-30-23-28(4)34(29(5)24-30)35(38)42(39,31-15-11-9-12-16-31)32-17-13-10-14-18-32/h9-20,23-24,27H,7-8,21-22,25-26H2,1-6H3/b20-19+ |
| InChIKey | SGLMQLQKFHLZFW-FMQUCBEESA-N |
| XLogP | 7.93 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.73 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|