C26H26ClO3P — CID 18515173
(2-chloro-6-methylphenyl)-[(2,3,4,5,6-pentamethylbenzoyl)-phenylphosphoryl]methanone (PubChem CID 18515173) has the molecular formula C26H26ClO3P and a molecular weight of 452.92 g/mol. Its IUPAC name is (2-chloro-6-methylphenyl)-[(2,3,4,5,6-pentamethylbenzoyl)-phenylphosphoryl]methanone.
| Compound Name | (2-chloro-6-methylphenyl)-[(2,3,4,5,6-pentamethylbenzoyl)-phenylphosphoryl]methanone |
|---|---|
| PubChem CID | 18515173 |
| Molecular Formula | C26H26ClO3P |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (2-chloro-6-methylphenyl)-[(2,3,4,5,6-pentamethylbenzoyl)-phenylphosphoryl]methanone |
| SMILES | Cc1cccc(Cl)c1C(=O)P(=O)(C(=O)c1c(C)c(C)c(C)c(C)c1C)c1ccccc1 |
| InChI | InChI=1S/C26H26ClO3P/c1-15-11-10-14-22(27)23(15)25(28)31(30,21-12-8-7-9-13-21)26(29)24-19(5)17(3)16(2)18(4)20(24)6/h7-14H,1-6H3 |
| InChIKey | VXDZUOIKMLOUFO-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|