C27H29O3P — CID 141015886
phenyl-[(2,3,5,6-tetramethylbenzoyl)-(2,3,4-trimethylphenyl)phosphoryl]methanone (PubChem CID 141015886) has the molecular formula C27H29O3P and a molecular weight of 432.50 g/mol. Its IUPAC name is phenyl-[(2,3,5,6-tetramethylbenzoyl)-(2,3,4-trimethylphenyl)phosphoryl]methanone.
| Compound Name | phenyl-[(2,3,5,6-tetramethylbenzoyl)-(2,3,4-trimethylphenyl)phosphoryl]methanone |
|---|---|
| PubChem CID | 141015886 |
| Molecular Formula | C27H29O3P |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | phenyl-[(2,3,5,6-tetramethylbenzoyl)-(2,3,4-trimethylphenyl)phosphoryl]methanone |
| SMILES | Cc1ccc(P(=O)(C(=O)c2ccccc2)C(=O)c2c(C)c(C)cc(C)c2C)c(C)c1C |
| InChI | InChI=1S/C27H29O3P/c1-16-13-14-24(22(7)19(16)4)31(30,26(28)23-11-9-8-10-12-23)27(29)25-20(5)17(2)15-18(3)21(25)6/h8-15H,1-7H3 |
| InChIKey | JPQPOTLLRSIDKU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|