C17H19O2P — CID 141198193
1-[phenyl-(2,3,4-trimethylphenyl)phosphoryl]ethanone (PubChem CID 141198193) has the molecular formula C17H19O2P and a molecular weight of 286.31 g/mol. Its IUPAC name is 1-[phenyl-(2,3,4-trimethylphenyl)phosphoryl]ethanone.
| Compound Name | 1-[phenyl-(2,3,4-trimethylphenyl)phosphoryl]ethanone |
|---|---|
| PubChem CID | 141198193 |
| Molecular Formula | C17H19O2P |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-[phenyl-(2,3,4-trimethylphenyl)phosphoryl]ethanone |
| SMILES | CC(=O)P(=O)(c1ccccc1)c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C17H19O2P/c1-12-10-11-17(14(3)13(12)2)20(19,15(4)18)16-8-6-5-7-9-16/h5-11H,1-4H3 |
| InChIKey | KJOIQBFIUWZARO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|