C16H13NO4 — CID 110273598
ethyl 3-hydroxy-1-oxobenzo[f]quinolizine-4-carboxylate (PubChem CID 110273598) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is ethyl 3-hydroxy-1-oxobenzo[f]quinolizine-4-carboxylate.
| Compound Name | ethyl 3-hydroxy-1-oxobenzo[f]quinolizine-4-carboxylate |
|---|---|
| PubChem CID | 110273598 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | ethyl 3-hydroxy-1-oxobenzo[f]quinolizine-4-carboxylate |
| SMILES | CCOC(=O)c1c(O)cc(=O)n2c1ccc1ccccc12 |
| InChI | InChI=1S/C16H13NO4/c1-2-21-16(20)15-12-8-7-10-5-3-4-6-11(10)17(12)14(19)9-13(15)18/h3-9,18H,2H2,1H3 |
| InChIKey | OIHJLMTYXSREEL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|