C12H18N2 — CID 142876995
ethane;3-ethyl-2-methyl-1H-pyrrolo[3,2-b]pyridine (PubChem CID 142876995) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is ethane;3-ethyl-2-methyl-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | ethane;3-ethyl-2-methyl-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 142876995 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | ethane;3-ethyl-2-methyl-1H-pyrrolo[3,2-b]pyridine |
| SMILES | CC.CCc1c(C)[nH]c2cccnc12 |
| InChI | InChI=1S/C10H12N2.C2H6/c1-3-8-7(2)12-9-5-4-6-11-10(8)9;1-2/h4-6,12H,3H2,1-2H3;1-2H3 |
| InChIKey | XYCHVFPPHADPLF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |