C24H26N3+ — CID 123485830
3-[3-(2,3-dimethylphenyl)-2-pyridinyl]-1-methyl-4-propan-2-ylbenzimidazol-3-ium (PubChem CID 123485830) has the molecular formula C24H26N3+ and a molecular weight of 356.49 g/mol. Its IUPAC name is 3-[3-(2,3-dimethylphenyl)-2-pyridinyl]-1-methyl-4-propan-2-ylbenzimidazol-3-ium.
| Compound Name | 3-[3-(2,3-dimethylphenyl)-2-pyridinyl]-1-methyl-4-propan-2-ylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 123485830 |
| Molecular Formula | C24H26N3+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 3-[3-(2,3-dimethylphenyl)-2-pyridinyl]-1-methyl-4-propan-2-ylbenzimidazol-3-ium |
| SMILES | Cc1cccc(-c2cccnc2-[n+]2cn(C)c3cccc(C(C)C)c32)c1C |
| InChI | InChI=1S/C24H26N3/c1-16(2)19-10-7-13-22-23(19)27(15-26(22)5)24-21(12-8-14-25-24)20-11-6-9-17(3)18(20)4/h6-16H,1-5H3/q+1 |
| InChIKey | DYQWUNMIAMSMFP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|