C13H20N2 — CID 177241545
ethane;1-methyl-3-propan-2-ylpyrrolo[3,2-b]pyridine (PubChem CID 177241545) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is ethane;1-methyl-3-propan-2-ylpyrrolo[3,2-b]pyridine.
| Compound Name | ethane;1-methyl-3-propan-2-ylpyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 177241545 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | ethane;1-methyl-3-propan-2-ylpyrrolo[3,2-b]pyridine |
| SMILES | CC.CC(C)c1cn(C)c2cccnc12 |
| InChI | InChI=1S/C11H14N2.C2H6/c1-8(2)9-7-13(3)10-5-4-6-12-11(9)10;1-2/h4-8H,1-3H3;1-2H3 |
| InChIKey | XPERGZZYIUEPIZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |