C22H24N2 — CID 130343427
7-cyclopentyl-4-(2,3,5-trimethylphenyl)quinazoline (PubChem CID 130343427) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 7-cyclopentyl-4-(2,3,5-trimethylphenyl)quinazoline.
| Compound Name | 7-cyclopentyl-4-(2,3,5-trimethylphenyl)quinazoline |
|---|---|
| PubChem CID | 130343427 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 7-cyclopentyl-4-(2,3,5-trimethylphenyl)quinazoline |
| SMILES | Cc1cc(C)c(C)c(-c2ncnc3cc(C4CCCC4)ccc23)c1 |
| InChI | InChI=1S/C22H24N2/c1-14-10-15(2)16(3)20(11-14)22-19-9-8-18(17-6-4-5-7-17)12-21(19)23-13-24-22/h8-13,17H,4-7H2,1-3H3 |
| InChIKey | ZBQIHQLYHQEAPG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |