C23H24N+ — CID 170222557
3-cyclopentyl-9,11-dimethyl-8H-isoindolo[1,2-a]isoquinolin-7-ium (PubChem CID 170222557) has the molecular formula C23H24N+ and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-cyclopentyl-9,11-dimethyl-8H-isoindolo[1,2-a]isoquinolin-7-ium.
| Compound Name | 3-cyclopentyl-9,11-dimethyl-8H-isoindolo[1,2-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 170222557 |
| Molecular Formula | C23H24N+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 3-cyclopentyl-9,11-dimethyl-8H-isoindolo[1,2-a]isoquinolin-7-ium |
| SMILES | Cc1cc(C)c2c(c1)-c1c3ccc(C4CCCC4)cc3cc[n+]1C2 |
| InChI | InChI=1S/C23H24N/c1-15-11-16(2)22-14-24-10-9-19-13-18(17-5-3-4-6-17)7-8-20(19)23(24)21(22)12-15/h7-13,17H,3-6,14H2,1-2H3/q+1 |
| InChIKey | UEZIUKMOEZXYNC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|