C25H29ClN+ — CID 169055353
2-(2-chloropropan-2-yl)-6-cyclopentyl-1-(3,5-dimethylphenyl)isoquinolin-2-ium (PubChem CID 169055353) has the molecular formula C25H29ClN+ and a molecular weight of 378.97 g/mol. Its IUPAC name is 2-(2-chloropropan-2-yl)-6-cyclopentyl-1-(3,5-dimethylphenyl)isoquinolin-2-ium.
| Compound Name | 2-(2-chloropropan-2-yl)-6-cyclopentyl-1-(3,5-dimethylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 169055353 |
| Molecular Formula | C25H29ClN+ |
| Molecular Weight | 378.97 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2-(2-chloropropan-2-yl)-6-cyclopentyl-1-(3,5-dimethylphenyl)isoquinolin-2-ium |
| SMILES | Cc1cc(C)cc(-c2c3ccc(C4CCCC4)cc3cc[n+]2C(C)(C)Cl)c1 |
| InChI | InChI=1S/C25H29ClN/c1-17-13-18(2)15-22(14-17)24-23-10-9-20(19-7-5-6-8-19)16-21(23)11-12-27(24)25(3,4)26/h9-16,19H,5-8H2,1-4H3/q+1 |
| InChIKey | VQHZHQKIOCQCBS-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.97 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|