C31H40N+ — CID 155639085
6-tert-butyl-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium (PubChem CID 155639085) has the molecular formula C31H40N+ and a molecular weight of 426.67 g/mol. Its IUPAC name is 6-tert-butyl-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium.
| Compound Name | 6-tert-butyl-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155639085 |
| Molecular Formula | C31H40N+ |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | 6-tert-butyl-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium |
| SMILES | Cc1c(-c2c3ccc(C(C)(C)C)cc3cc[n+]2C)cc(C2CCCC2)cc1C1CCCC1 |
| InChI | InChI=1S/C31H40N/c1-21-28(23-12-8-9-13-23)19-25(22-10-6-7-11-22)20-29(21)30-27-15-14-26(31(2,3)4)18-24(27)16-17-32(30)5/h14-20,22-23H,6-13H2,1-5H3/q+1 |
| InChIKey | YAIYRLNMKHGTJS-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|