C30H42NSi+ — CID 155638086
tert-butyl-[1-(5-cyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diethylsilane (PubChem CID 155638086) has the molecular formula C30H42NSi+ and a molecular weight of 444.76 g/mol. Its IUPAC name is tert-butyl-[1-(5-cyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diethylsilane.
| Compound Name | tert-butyl-[1-(5-cyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diethylsilane |
|---|---|
| PubChem CID | 155638086 |
| Molecular Formula | C30H42NSi+ |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | tert-butyl-[1-(5-cyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diethylsilane |
| SMILES | CC[Si](CC)(c1ccc2c(-c3cc(C4CCCC4)ccc3C)[n+](C)ccc2c1)C(C)(C)C |
| InChI | InChI=1S/C30H42NSi/c1-8-32(9-2,30(4,5)6)26-16-17-27-25(20-26)18-19-31(7)29(27)28-21-24(15-14-22(28)3)23-12-10-11-13-23/h14-21,23H,8-13H2,1-7H3/q+1 |
| InChIKey | PPKPUFMDYNJJQG-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|