C28H36NSi+ — CID 155637786
[1-(5-cyclohexyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-cyclopropyl-dimethylsilane (PubChem CID 155637786) has the molecular formula C28H36NSi+ and a molecular weight of 414.69 g/mol. Its IUPAC name is [1-(5-cyclohexyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-cyclopropyl-dimethylsilane.
| Compound Name | [1-(5-cyclohexyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-cyclopropyl-dimethylsilane |
|---|---|
| PubChem CID | 155637786 |
| Molecular Formula | C28H36NSi+ |
| Molecular Weight | 414.69 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [1-(5-cyclohexyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-cyclopropyl-dimethylsilane |
| SMILES | Cc1ccc(C2CCCCC2)cc1-c1c2ccc([Si](C)(C)C3CC3)cc2cc[n+]1C |
| InChI | InChI=1S/C28H36NSi/c1-20-10-11-22(21-8-6-5-7-9-21)19-27(20)28-26-15-14-25(30(3,4)24-12-13-24)18-23(26)16-17-29(28)2/h10-11,14-19,21,24H,5-9,12-13H2,1-4H3/q+1 |
| InChIKey | LGQQHQUYYIXOFU-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.69 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|