C31H36NSi+ — CID 155638337
cyclohexyl-dimethyl-[2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]silane (PubChem CID 155638337) has the molecular formula C31H36NSi+ and a molecular weight of 450.72 g/mol. Its IUPAC name is cyclohexyl-dimethyl-[2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]silane.
| Compound Name | cyclohexyl-dimethyl-[2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]silane |
|---|---|
| PubChem CID | 155638337 |
| Molecular Formula | C31H36NSi+ |
| Molecular Weight | 450.72 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | cyclohexyl-dimethyl-[2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]silane |
| SMILES | Cc1ccc(-c2ccccc2)cc1-c1c2ccc([Si](C)(C)C3CCCCC3)cc2cc[n+]1C |
| InChI | InChI=1S/C31H36NSi/c1-23-15-16-25(24-11-7-5-8-12-24)22-30(23)31-29-18-17-28(21-26(29)19-20-32(31)2)33(3,4)27-13-9-6-10-14-27/h5,7-8,11-12,15-22,27H,6,9-10,13-14H2,1-4H3/q+1 |
| InChIKey | ZGTLJNOFZHUXPD-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.72 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|