C35H46NSi+ — CID 155637749
[2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]-tris(2-methylpropyl)silane (PubChem CID 155637749) has the molecular formula C35H46NSi+ and a molecular weight of 508.85 g/mol. Its IUPAC name is [2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]-tris(2-methylpropyl)silane.
| Compound Name | [2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]-tris(2-methylpropyl)silane |
|---|---|
| PubChem CID | 155637749 |
| Molecular Formula | C35H46NSi+ |
| Molecular Weight | 508.85 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | [2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]-tris(2-methylpropyl)silane |
| SMILES | Cc1ccc(-c2ccccc2)cc1-c1c2ccc([Si](CC(C)C)(CC(C)C)CC(C)C)cc2cc[n+]1C |
| InChI | InChI=1S/C35H46NSi/c1-25(2)22-37(23-26(3)4,24-27(5)6)32-16-17-33-31(20-32)18-19-36(8)35(33)34-21-30(15-14-28(34)7)29-12-10-9-11-13-29/h9-21,25-27H,22-24H2,1-8H3/q+1 |
| InChIKey | UMDSRINWRFUNPQ-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.85 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|