C32H40NSi+ — CID 155638144
triethyl-[2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]silane (PubChem CID 155638144) has the molecular formula C32H40NSi+ and a molecular weight of 466.77 g/mol. Its IUPAC name is triethyl-[2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]silane.
| Compound Name | triethyl-[2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]silane |
|---|---|
| PubChem CID | 155638144 |
| Molecular Formula | C32H40NSi+ |
| Molecular Weight | 466.77 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | triethyl-[2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]silane |
| SMILES | CC[Si](CC)(CC)c1ccc2c(-c3cc(-c4ccccc4)cc(C(C)C)c3C)[n+](C)ccc2c1 |
| InChI | InChI=1S/C32H40NSi/c1-8-34(9-2,10-3)28-16-17-29-26(20-28)18-19-33(7)32(29)31-22-27(25-14-12-11-13-15-25)21-30(23(4)5)24(31)6/h11-23H,8-10H2,1-7H3/q+1 |
| InChIKey | UOUCTJXLZWEMIA-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.77 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|