C29H32N+ — CID 158337815
3,4-dideuterio-2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)-6-propan-2-ylisoquinolin-2-ium (PubChem CID 158337815) has the molecular formula C29H32N+ and a molecular weight of 396.59 g/mol. Its IUPAC name is 3,4-dideuterio-2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)-6-propan-2-ylisoquinolin-2-ium.
| Compound Name | 3,4-dideuterio-2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)-6-propan-2-ylisoquinolin-2-ium |
|---|---|
| PubChem CID | 158337815 |
| Molecular Formula | C29H32N+ |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 3,4-dideuterio-2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)-6-propan-2-ylisoquinolin-2-ium |
| SMILES | [2H]c1c([2H])[n+](C)c(-c2cc(-c3ccccc3)cc(C(C)C)c2C)c2ccc(C(C)C)cc12 |
| InChI | InChI=1S/C29H32N/c1-19(2)23-12-13-26-24(16-23)14-15-30(6)29(26)28-18-25(22-10-8-7-9-11-22)17-27(20(3)4)21(28)5/h7-20H,1-6H3/q+1/i14D,15D |
| InChIKey | MNVVNZVOOGTVQD-CNMMZHPCSA-N |
| XLogP | 7.55 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|