C34H36NSi+ — CID 155639415
[3-deuterio-2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]-dimethyl-phenylsilane (PubChem CID 155639415) has the molecular formula C34H36NSi+ and a molecular weight of 487.76 g/mol. Its IUPAC name is [3-deuterio-2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]-dimethyl-phenylsilane.
| Compound Name | [3-deuterio-2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 155639415 |
| Molecular Formula | C34H36NSi+ |
| Molecular Weight | 487.76 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | [3-deuterio-2-methyl-1-(2-methyl-5-phenyl-3-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
| SMILES | [2H]c1cc2cc([Si](C)(C)c3ccccc3)ccc2c(-c2cc(-c3ccccc3)cc(C(C)C)c2C)[n+]1C |
| InChI | InChI=1S/C34H36NSi/c1-24(2)32-22-28(26-13-9-7-10-14-26)23-33(25(32)3)34-31-18-17-30(21-27(31)19-20-35(34)4)36(5,6)29-15-11-8-12-16-29/h7-24H,1-6H3/q+1/i20D |
| InChIKey | IBXRVVZXVUOZGW-YVHRXSIGSA-N |
| XLogP | 7.25 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.76 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|