C29H34NSi+ — CID 162016601
[4-deuterio-2,3-dimethyl-1-(2-methyl-5-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]-dimethyl-phenylsilane (PubChem CID 162016601) has the molecular formula C29H34NSi+ and a molecular weight of 425.69 g/mol. Its IUPAC name is [4-deuterio-2,3-dimethyl-1-(2-methyl-5-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]-dimethyl-phenylsilane.
| Compound Name | [4-deuterio-2,3-dimethyl-1-(2-methyl-5-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 162016601 |
| Molecular Formula | C29H34NSi+ |
| Molecular Weight | 425.69 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | [4-deuterio-2,3-dimethyl-1-(2-methyl-5-propan-2-ylphenyl)isoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C(C)C)ccc2C)c2ccc([Si](C)(C)c3ccccc3)cc12 |
| InChI | InChI=1S/C29H34NSi/c1-20(2)23-14-13-21(3)28(19-23)29-27-16-15-26(18-24(27)17-22(4)30(29)5)31(6,7)25-11-9-8-10-12-25/h8-20H,1-7H3/q+1/i17D |
| InChIKey | JQNRGSFJQJGLLU-OKWSDYJOSA-N |
| XLogP | 5.89 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.69 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|