C27H30NSi+ — CID 158444881
[4-deuterio-1-(2,5-dimethylphenyl)-2,3-dimethylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane (PubChem CID 158444881) has the molecular formula C27H30NSi+ and a molecular weight of 397.64 g/mol. Its IUPAC name is [4-deuterio-1-(2,5-dimethylphenyl)-2,3-dimethylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane.
| Compound Name | [4-deuterio-1-(2,5-dimethylphenyl)-2,3-dimethylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 158444881 |
| Molecular Formula | C27H30NSi+ |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | [4-deuterio-1-(2,5-dimethylphenyl)-2,3-dimethylisoquinolin-2-ium-6-yl]-dimethyl-phenylsilane |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C)ccc2C)c2ccc([Si](C)(C)c3ccccc3)cc12 |
| InChI | InChI=1S/C27H30NSi/c1-19-12-13-20(2)26(16-19)27-25-15-14-24(18-22(25)17-21(3)28(27)4)29(5,6)23-10-8-7-9-11-23/h7-18H,1-6H3/q+1/i17D |
| InChIKey | ONJRYWDZTXKXQX-OKWSDYJOSA-N |
| XLogP | 5.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|